C37H38N2O6 — CID 6191868
(4E)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6191868) has the molecular formula C37H38N2O6 and a molecular weight of 606.72 g/mol. Its IUPAC name is (4E)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6191868 |
| Molecular Formula | C37H38N2O6 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (4E)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCN(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H38N2O6/c1-25-10-8-9-13-29(25)24-44-30-17-14-27(15-18-30)35(40)33-34(39(21-20-38(2)3)37(42)36(33)41)28-16-19-31(32(22-28)43-4)45-23-26-11-6-5-7-12-26/h5-19,22,34,40H,20-21,23-24H2,1-4H3/b35-33+ |
| InChIKey | SVCNYDIPZMGSGX-LAPDZXRHSA-N |
| XLogP | 6.14 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|