C16H26N4O3 — CID 46995765
N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide (PubChem CID 46995765) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide.
| Compound Name | N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 46995765 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide |
| SMILES | COCC(NC(=O)CCC(=O)NC1CCCC1)c1ccnn1C |
| InChI | InChI=1S/C16H26N4O3/c1-20-14(9-10-17-20)13(11-23-2)19-16(22)8-7-15(21)18-12-5-3-4-6-12/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | KPPQQSYASCAUHG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |