About N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide
N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide (PubChem CID 46995765) has the molecular formula C16H26N4O3
and a molecular weight of 322.41 g/mol. Its IUPAC name is N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide |
| PubChem CID | 46995765 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide |
| SMILES | COCC(NC(=O)CCC(=O)NC1CCCC1)c1ccnn1C |
| InChI | InChI=1S/C16H26N4O3/c1-20-14(9-10-17-20)13(11-23-2)19-16(22)8-7-15(21)18-12-5-3-4-6-12/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | KPPQQSYASCAUHG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide?
The IUPAC name of N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide (CID 46995765) is N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide.
What is the SMILES notation for N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide?
The canonical SMILES for N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide is COCC(NC(=O)CCC(=O)NC1CCCC1)c1ccnn1C.
What is the InChIKey of N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide?
The InChIKey is KPPQQSYASCAUHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O3/c1-20-14(9-10-17-20)13(11-23-2)19-16(22)8-7-15(21)18-12-5-3-4-6-12/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,21)(H,19,22).
What are the key properties of N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide?
N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide has a molecular weight of 322.41 g/mol, XLogP of 1.06, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N'-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]butanediamide is sourced from PubChem (CID 46995765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).