C22H25N3O3 — CID 46996832
3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]propanamide (PubChem CID 46996832) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]propanamide.
| Compound Name | 3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 46996832 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]propanamide |
| SMILES | COc1ccccc1-c1noc(CCC(=O)NC[C@H]2C[C@H]3C=C[C@H]2C32CC2)n1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-18-5-3-2-4-16(18)21-24-20(28-25-21)9-8-19(26)23-13-14-12-15-6-7-17(14)22(15)10-11-22/h2-7,14-15,17H,8-13H2,1H3,(H,23,26)/t14-,15-,17-/m1/s1 |
| InChIKey | GLBYDAGXJNZTBK-BFYDXBDKSA-N |
| XLogP | 3.40 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|