C19H24N6 — CID 46998060
6-(2-aminoethyl)-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]pyrimidin-4-amine (PubChem CID 46998060) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-(2-aminoethyl)-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]pyrimidin-4-amine.
| Compound Name | 6-(2-aminoethyl)-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46998060 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 6-(2-aminoethyl)-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]pyrimidin-4-amine |
| SMILES | Cc1nccn1CCC(Nc1cc(CCN)ncn1)c1ccccc1 |
| InChI | InChI=1S/C19H24N6/c1-15-21-10-12-25(15)11-8-18(16-5-3-2-4-6-16)24-19-13-17(7-9-20)22-14-23-19/h2-6,10,12-14,18H,7-9,11,20H2,1H3,(H,22,23,24) |
| InChIKey | HPTVAOZEKXFIIM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |