C19H23N7 — CID 46998124
4-[4-[[4-(4-methylphenyl)triazol-1-yl]methyl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 46998124) has the molecular formula C19H23N7 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[4-[[4-(4-methylphenyl)triazol-1-yl]methyl]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[[4-(4-methylphenyl)triazol-1-yl]methyl]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 46998124 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-[4-[[4-(4-methylphenyl)triazol-1-yl]methyl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2cn(CC3CCN(c4ccnc(N)n4)CC3)nn2)cc1 |
| InChI | InChI=1S/C19H23N7/c1-14-2-4-16(5-3-14)17-13-26(24-23-17)12-15-7-10-25(11-8-15)18-6-9-21-19(20)22-18/h2-6,9,13,15H,7-8,10-12H2,1H3,(H2,20,21,22) |
| InChIKey | RSEPNWFQDHXZSB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |