C16H17ClN2O2S — CID 46998192
(2R)-1-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 46998192) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is (2R)-1-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46998192 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (2R)-1-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1Cc1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C16H17ClN2O2S/c17-11-3-6-13(7-4-11)22-15-8-5-12(21-15)10-19-9-1-2-14(19)16(18)20/h3-8,14H,1-2,9-10H2,(H2,18,20)/t14-/m1/s1 |
| InChIKey | HPOPUFZVLHUPIF-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |