C18H18N4O2S2 — CID 45183586
5-[1-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methyl]pyrrolidin-2-yl]thiophene-2-carboxamide (PubChem CID 45183586) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 5-[1-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methyl]pyrrolidin-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-[1-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45183586 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 5-[1-[(5-pyrimidin-2-ylsulfanylfuran-2-yl)methyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(C2CCCN2Cc2ccc(Sc3ncccn3)o2)s1 |
| InChI | InChI=1S/C18H18N4O2S2/c19-17(23)15-6-5-14(25-15)13-3-1-10-22(13)11-12-4-7-16(24-12)26-18-20-8-2-9-21-18/h2,4-9,13H,1,3,10-11H2,(H2,19,23) |
| InChIKey | HNWPUGMBENIULK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |