C19H25N3O2 — CID 46998485
N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide (PubChem CID 46998485) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 46998485 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)N(C)C(C)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C19H25N3O2/c1-12(2)11-24-17-10-8-7-9-16(17)19(23)22(6)15(5)18-13(3)20-21-14(18)4/h7-10,15H,1,11H2,2-6H3,(H,20,21) |
| InChIKey | LJPKFCKWMCVIOM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|