C17H21N3O3 — CID 46987339
N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide (PubChem CID 46987339) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 46987339 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-2-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)N(C)Cc1noc(CC)n1 |
| InChI | InChI=1S/C17H21N3O3/c1-5-16-18-15(19-23-16)10-20(4)17(21)13-8-6-7-9-14(13)22-11-12(2)3/h6-9H,2,5,10-11H2,1,3-4H3 |
| InChIKey | PNTBGXJZGVPZPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|