C18H16N6OS — CID 46998758
N-(1-benzylpyrazol-3-yl)-2-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]acetamide (PubChem CID 46998758) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(1-benzylpyrazol-3-yl)-2-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]acetamide.
| Compound Name | N-(1-benzylpyrazol-3-yl)-2-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 46998758 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(1-benzylpyrazol-3-yl)-2-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(-c2nccs2)cn1)Nc1ccn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H16N6OS/c25-17(13-24-12-15(10-20-24)18-19-7-9-26-18)21-16-6-8-23(22-16)11-14-4-2-1-3-5-14/h1-10,12H,11,13H2,(H,21,22,25) |
| InChIKey | KKRRKOGMMRGWLH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |