C20H25FN2O2 — CID 47000128
2-[benzyl-[2-(dimethylamino)ethyl]amino]-2-(4-fluoro-3-methylphenyl)acetic acid (PubChem CID 47000128) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[benzyl-[2-(dimethylamino)ethyl]amino]-2-(4-fluoro-3-methylphenyl)acetic acid.
| Compound Name | 2-[benzyl-[2-(dimethylamino)ethyl]amino]-2-(4-fluoro-3-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 47000128 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[benzyl-[2-(dimethylamino)ethyl]amino]-2-(4-fluoro-3-methylphenyl)acetic acid |
| SMILES | Cc1cc(C(C(=O)O)N(CCN(C)C)Cc2ccccc2)ccc1F |
| InChI | InChI=1S/C20H25FN2O2/c1-15-13-17(9-10-18(15)21)19(20(24)25)23(12-11-22(2)3)14-16-7-5-4-6-8-16/h4-10,13,19H,11-12,14H2,1-3H3,(H,24,25) |
| InChIKey | GPYDJULISJQNEQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |