C6H8N2OS — CID 47002207
N,2-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 47002207) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is N,2-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N,2-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47002207 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | N,2-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C6H8N2OS/c1-4-8-3-5(10-4)6(9)7-2/h3H,1-2H3,(H,7,9) |
| InChIKey | PUIJVJNJITYIIM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |