About 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride
3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride (PubChem CID 47002397) has the molecular formula C15H17Cl3N4
and a molecular weight of 359.69 g/mol. Its IUPAC name is 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride.
Molecular Properties
| Compound Name | 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride |
| PubChem CID | 47002397 |
| Molecular Formula | C15H17Cl3N4 |
| Molecular Weight | 359.69 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.[H]/N=C(\N)c1cccc(Cn2cnc3ccccc32)c1 |
| InChI | InChI=1S/C15H14N4.3ClH/c16-15(17)12-5-3-4-11(8-12)9-19-10-18-13-6-1-2-7-14(13)19;;;/h1-8,10H,9H2,(H3,16,17);3*1H |
| InChIKey | GCTRTLCDKJYIKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride?
The IUPAC name of 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride (CID 47002397) is 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride.
What is the SMILES notation for 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride?
The canonical SMILES for 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride is Cl.Cl.Cl.[H]/N=C(\N)c1cccc(Cn2cnc3ccccc32)c1.
What is the InChIKey of 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride?
The InChIKey is GCTRTLCDKJYIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4.3ClH/c16-15(17)12-5-3-4-11(8-12)9-19-10-18-13-6-1-2-7-14(13)19;;;/h1-8,10H,9H2,(H3,16,17);3*1H.
What are the key properties of 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride?
3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride has a molecular weight of 359.69 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzimidazol-1-ylmethyl)benzenecarboximidamide;trihydrochloride is sourced from PubChem (CID 47002397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).