C26H26N6 — CID 91348222
3-[[1-[1-[(3-carbamimidoylphenyl)methyl]indol-3-yl]ethylideneamino]methyl]benzenecarboximidamide (PubChem CID 91348222) has the molecular formula C26H26N6 and a molecular weight of 422.54 g/mol. Its IUPAC name is 3-[[1-[1-[(3-carbamimidoylphenyl)methyl]indol-3-yl]ethylideneamino]methyl]benzenecarboximidamide.
| Compound Name | 3-[[1-[1-[(3-carbamimidoylphenyl)methyl]indol-3-yl]ethylideneamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 91348222 |
| Molecular Formula | C26H26N6 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 3-[[1-[1-[(3-carbamimidoylphenyl)methyl]indol-3-yl]ethylideneamino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C/N=C(\C)c2cn(Cc3cccc(/C(N)=N/[H])c3)c3ccccc23)c1 |
| InChI | InChI=1S/C26H26N6/c1-17(31-14-18-6-4-8-20(12-18)25(27)28)23-16-32(24-11-3-2-10-22(23)24)15-19-7-5-9-21(13-19)26(29)30/h2-13,16H,14-15H2,1H3,(H3,27,28)(H3,29,30)/b31-17+ |
| InChIKey | UCEUEYRGFVIBSB-KBVAKVRCSA-N |
| XLogP | 4.27 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|