About 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride
1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride (PubChem CID 47002949) has the molecular formula C11H26Cl3N3O
and a molecular weight of 322.71 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride.
Molecular Properties
| Compound Name | 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride |
| PubChem CID | 47002949 |
| Molecular Formula | C11H26Cl3N3O |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC1CCN(CCN2CCOCC2)CC1 |
| InChI | InChI=1S/C11H23N3O.3ClH/c12-11-1-3-13(4-2-11)5-6-14-7-9-15-10-8-14;;;/h11H,1-10,12H2;3*1H |
| InChIKey | YENHEZHJLRKQKA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride?
The IUPAC name of 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride (CID 47002949) is 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride.
What is the SMILES notation for 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride?
The canonical SMILES for 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride is Cl.Cl.Cl.NC1CCN(CCN2CCOCC2)CC1.
What is the InChIKey of 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride?
The InChIKey is YENHEZHJLRKQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O.3ClH/c12-11-1-3-13(4-2-11)5-6-14-7-9-15-10-8-14;;;/h11H,1-10,12H2;3*1H.
What are the key properties of 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride?
1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride has a molecular weight of 322.71 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-morpholin-4-ylethyl)piperidin-4-amine;trihydrochloride is sourced from PubChem (CID 47002949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).