C7H12N4O — CID 47003138
2-(3-aminopyrazol-1-yl)-N,N-dimethylacetamide (PubChem CID 47003138) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 47003138 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C7H12N4O/c1-10(2)7(12)5-11-4-3-6(8)9-11/h3-4H,5H2,1-2H3,(H2,8,9) |
| InChIKey | RMGGQGYJERSBJF-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |