About 2-pyrazol-1-ylacetamide
2-pyrazol-1-ylacetamide (PubChem CID 14028978) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 2-pyrazol-1-ylacetamide.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylacetamide |
| PubChem CID | 14028978 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 2-pyrazol-1-ylacetamide |
| SMILES | NC(=O)Cn1cccn1 |
| InChI | InChI=1S/C5H7N3O/c6-5(9)4-8-3-1-2-7-8/h1-3H,4H2,(H2,6,9) |
| InChIKey | PTGHHGHHFPDNBR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazol-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylacetamide?
The IUPAC name of 2-pyrazol-1-ylacetamide (CID 14028978) is 2-pyrazol-1-ylacetamide.
What is the SMILES notation for 2-pyrazol-1-ylacetamide?
The canonical SMILES for 2-pyrazol-1-ylacetamide is NC(=O)Cn1cccn1.
What is the InChIKey of 2-pyrazol-1-ylacetamide?
The InChIKey is PTGHHGHHFPDNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O/c6-5(9)4-8-3-1-2-7-8/h1-3H,4H2,(H2,6,9).
What are the key properties of 2-pyrazol-1-ylacetamide?
2-pyrazol-1-ylacetamide has a molecular weight of 125.13 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylacetamide is sourced from PubChem (CID 14028978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).