About 1-pyrazol-1-ylethanone
1-pyrazol-1-ylethanone (PubChem CID 549278) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is 1-pyrazol-1-ylethanone.
Molecular Properties
| Compound Name | 1-pyrazol-1-ylethanone |
| PubChem CID | 549278 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 1-pyrazol-1-ylethanone |
| SMILES | CC(=O)n1cccn1 |
| InChI | InChI=1S/C5H6N2O/c1-5(8)7-4-2-3-6-7/h2-4H,1H3 |
| InChIKey | PGFTUYZICNEFJQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyrazol-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazol-1-ylethanone?
The IUPAC name of 1-pyrazol-1-ylethanone (CID 549278) is 1-pyrazol-1-ylethanone.
What is the SMILES notation for 1-pyrazol-1-ylethanone?
The canonical SMILES for 1-pyrazol-1-ylethanone is CC(=O)n1cccn1.
What is the InChIKey of 1-pyrazol-1-ylethanone?
The InChIKey is PGFTUYZICNEFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O/c1-5(8)7-4-2-3-6-7/h2-4H,1H3.
What are the key properties of 1-pyrazol-1-ylethanone?
1-pyrazol-1-ylethanone has a molecular weight of 110.12 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazol-1-ylethanone is sourced from PubChem (CID 549278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).