C18H24BrNOS — CID 47003827
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[(3-bromophenyl)methylsulfanyl]acetamide (PubChem CID 47003827) has the molecular formula C18H24BrNOS and a molecular weight of 382.37 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[(3-bromophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[(3-bromophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 47003827 |
| Molecular Formula | C18H24BrNOS |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-[(3-bromophenyl)methylsulfanyl]acetamide |
| SMILES | CC(NC(=O)CSCc1cccc(Br)c1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H24BrNOS/c1-12(17-9-13-5-6-15(17)7-13)20-18(21)11-22-10-14-3-2-4-16(19)8-14/h2-4,8,12-13,15,17H,5-7,9-11H2,1H3,(H,20,21) |
| InChIKey | MNFMKNHOQGCCDG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |