C21H21NO4 — CID 47004107
phenacyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 47004107) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is phenacyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | phenacyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 47004107 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | phenacyl 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CC(=O)N(CCc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4/c23-19(17-9-5-2-6-10-17)15-26-21(25)18-13-20(24)22(14-18)12-11-16-7-3-1-4-8-16/h1-10,18H,11-15H2 |
| InChIKey | FYLDYGRVGPMAQD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |