C22H23N3O5 — CID 7898498
[2-(2-benzoylhydrazinyl)-2-oxoethyl] (3S)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 7898498) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] (3S)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (3S)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7898498 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (3S)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CC(=O)N(CCc2ccccc2)C1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O5/c26-19(23-24-21(28)17-9-5-2-6-10-17)15-30-22(29)18-13-20(27)25(14-18)12-11-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,23,26)(H,24,28)/t18-/m0/s1 |
| InChIKey | JKQMTCAWXSUFRG-SFHVURJKSA-N |
| XLogP | 1.08 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|