C15H15N3O4S — CID 47004572
N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide (PubChem CID 47004572) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 47004572 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(C)c(C(=O)NNC(=O)C2COc3ccccc3O2)s1 |
| InChI | InChI=1S/C15H15N3O4S/c1-8-13(23-9(2)16-8)15(20)18-17-14(19)12-7-21-10-5-3-4-6-11(10)22-12/h3-6,12H,7H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | FSMPDXKSPLAMFV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|