C16H20N4O4S — CID 47004794
N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 47004794) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47004794 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(NC(=O)c2cnc(C)cn2)cc1 |
| InChI | InChI=1S/C16H20N4O4S/c1-11-8-18-15(9-17-11)16(21)19-13-4-6-14(7-5-13)25(22,23)20-12(2)10-24-3/h4-9,12,20H,10H2,1-3H3,(H,19,21) |
| InChIKey | BTOUQGMUTRLRNT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |