C24H27N3O3 — CID 47005438
N-[2-(3-methoxyanilino)-2-oxoethyl]-N,2,5-trimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide (PubChem CID 47005438) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-(3-methoxyanilino)-2-oxoethyl]-N,2,5-trimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N,2,5-trimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 47005438 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N,2,5-trimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)c2cc(C)n(-c3cccc(C)c3)c2C)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-16-8-6-10-20(12-16)27-17(2)13-22(18(27)3)24(29)26(4)15-23(28)25-19-9-7-11-21(14-19)30-5/h6-14H,15H2,1-5H3,(H,25,28) |
| InChIKey | JSGMYGHPHNBMEW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|