C21H30N2O6 — CID 47006554
N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2-methoxyphenyl)ethylamino]acetamide;oxalic acid (PubChem CID 47006554) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2-methoxyphenyl)ethylamino]acetamide;oxalic acid.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2-methoxyphenyl)ethylamino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 47006554 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2-methoxyphenyl)ethylamino]acetamide;oxalic acid |
| SMILES | COc1ccccc1C(C)NCC(=O)NCCC1=CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H28N2O2.C2H2O4/c1-15(17-10-6-7-11-18(17)23-2)21-14-19(22)20-13-12-16-8-4-3-5-9-16;3-1(4)2(5)6/h6-8,10-11,15,21H,3-5,9,12-14H2,1-2H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | GHFNDWICQJAHES-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|