C23H27FN4O2 — CID 47007374
3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 47007374) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is 3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47007374 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(N2CCN(CN3C(=O)C(C)N(c4ccc(F)cc4)C3=O)CC2)c1C |
| InChI | InChI=1S/C23H27FN4O2/c1-16-5-4-6-21(17(16)2)26-13-11-25(12-14-26)15-27-22(29)18(3)28(23(27)30)20-9-7-19(24)8-10-20/h4-10,18H,11-15H2,1-3H3 |
| InChIKey | BKMOMCFZDBKMJL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|