C16H23F3N2O2 — CID 47009844
N-(6-methylheptan-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 47009844) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(6-methylheptan-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 47009844 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(6-methylheptan-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(C)CCCC(C)NC(=O)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C16H23F3N2O2/c1-11(2)5-4-6-12(3)20-14(22)10-21-9-13(16(17,18)19)7-8-15(21)23/h7-9,11-12H,4-6,10H2,1-3H3,(H,20,22) |
| InChIKey | KJIIELZZUDNYAX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |