C15H16F3N3O3 — CID 53550143
N'-(dicyclopropylmethyl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]oxamide (PubChem CID 53550143) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.30 g/mol. Its IUPAC name is N'-(dicyclopropylmethyl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]oxamide.
| Compound Name | N'-(dicyclopropylmethyl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]oxamide |
|---|---|
| PubChem CID | 53550143 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N'-(dicyclopropylmethyl)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]oxamide |
| SMILES | C1CC1C(C2CC2)NC(=O)C(=O)NC3=CC(=CNC3=O)C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O3/c16-15(17,18)9-5-10(12(22)19-6-9)20-13(23)14(24)21-11(7-1-2-7)8-3-4-8/h5-8,11H,1-4H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | KKTOBXCTCPDDHZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 634 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|