C14H20F3N3O2 — CID 135186733
2-[3-amino-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-ethylbutyl)acetamide (PubChem CID 135186733) has the molecular formula C14H20F3N3O2 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-[3-amino-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-ethylbutyl)acetamide.
| Compound Name | 2-[3-amino-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-ethylbutyl)acetamide |
|---|---|
| PubChem CID | 135186733 |
| Molecular Formula | C14H20F3N3O2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[3-amino-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-ethylbutyl)acetamide |
| SMILES | CCC(CC)CNC(=O)Cn1cc(C(F)(F)F)cc(N)c1=O |
| InChI | InChI=1S/C14H20F3N3O2/c1-3-9(4-2)6-19-12(21)8-20-7-10(14(15,16)17)5-11(18)13(20)22/h5,7,9H,3-4,6,8,18H2,1-2H3,(H,19,21) |
| InChIKey | GVFQRISZDHEUQI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |