C19H23N3O5 — CID 47011606
[1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 47011606) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is [1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 47011606 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)CCC1=O)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N3O5/c1-14(27-18(25)13-22-16(23)7-8-17(22)24)19(26)21-11-9-20(10-12-21)15-5-3-2-4-6-15/h2-6,14H,7-13H2,1H3 |
| InChIKey | CVIIEAOGDDWSIF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|