C19H22N2O4 — CID 25340897
[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 3-methylfuran-2-carboxylate (PubChem CID 25340897) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 3-methylfuran-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 25340897 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl] 3-methylfuran-2-carboxylate |
| SMILES | Cc1ccoc1C(=O)O[C@H](C)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O4/c1-14-8-13-24-17(14)19(23)25-15(2)18(22)21-11-9-20(10-12-21)16-6-4-3-5-7-16/h3-8,13,15H,9-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | MEXUGQFNXOBLAA-OAHLLOKOSA-N |
| XLogP | 2.48 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |