C19H22N2O6S — CID 9384736
[(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate (PubChem CID 9384736) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate.
| Compound Name | [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 9384736 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)O[C@H](C)C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O6S/c1-14-17(8-13-26-14)19(23)27-15(2)18(22)20-9-11-21(12-10-20)28(24,25)16-6-4-3-5-7-16/h3-8,13,15H,9-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | HQNOXMQDWGRXIU-OAHLLOKOSA-N |
| XLogP | 1.67 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |