C20H20ClN3O7S — CID 16797607
[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate (PubChem CID 16797607) has the molecular formula C20H20ClN3O7S and a molecular weight of 481.91 g/mol. Its IUPAC name is [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate.
| Compound Name | [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 16797607 |
| Molecular Formula | C20H20ClN3O7S |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20ClN3O7S/c1-14(31-20(26)17-8-7-15(21)13-18(17)24(27)28)19(25)22-9-11-23(12-10-22)32(29,30)16-5-3-2-4-6-16/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | ZVPKGXXBYOSPRM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|