C16H18Cl2N2O4 — CID 55524833
[1-(4-acetylpiperazin-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate (PubChem CID 55524833) has the molecular formula C16H18Cl2N2O4 and a molecular weight of 373.24 g/mol. Its IUPAC name is [1-(4-acetylpiperazin-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate.
| Compound Name | [1-(4-acetylpiperazin-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 55524833 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | [1-(4-acetylpiperazin-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate |
| SMILES | CC(=O)N1CCN(C(=O)C(C)OC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-10(15(22)20-7-5-19(6-8-20)11(2)21)24-16(23)13-9-12(17)3-4-14(13)18/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | ILRAXLYJTOVCLX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |