C31H30N4O4S3 — CID 4701265
N,N-diethyl-3-[4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide (PubChem CID 4701265) has the molecular formula C31H30N4O4S3 and a molecular weight of 618.81 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4701265 |
| Molecular Formula | C31H30N4O4S3 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | N,N-diethyl-3-[4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(Cc3ccc(OC)cc3)C2=O)c1 |
| InChI | InChI=1S/C31H30N4O4S3/c1-4-33(5-2)42(37,38)27-13-9-10-23(18-27)29-24(21-35(32-29)25-11-7-6-8-12-25)19-28-30(36)34(31(40)41-28)20-22-14-16-26(39-3)17-15-22/h6-19,21H,4-5,20H2,1-3H3 |
| InChIKey | AXGABNQDORUFEA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|