C16H18BrNO3S — CID 47015119
2-bromo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzenesulfonamide (PubChem CID 47015119) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47015119 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-bromo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzenesulfonamide |
| SMILES | CC1CC1c1ccc(CN(C)S(=O)(=O)c2ccccc2Br)o1 |
| InChI | InChI=1S/C16H18BrNO3S/c1-11-9-13(11)15-8-7-12(21-15)10-18(2)22(19,20)16-6-4-3-5-14(16)17/h3-8,11,13H,9-10H2,1-2H3 |
| InChIKey | UZCLKNHHQAVPMB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |