C17H20N2O5S — CID 98691157
N,2-dimethyl-N-[[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methyl]-6-nitrobenzenesulfonamide (PubChem CID 98691157) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N,2-dimethyl-N-[[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methyl]-6-nitrobenzenesulfonamide.
| Compound Name | N,2-dimethyl-N-[[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methyl]-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 98691157 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N,2-dimethyl-N-[[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methyl]-6-nitrobenzenesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)N(C)Cc1ccc([C@H]2C[C@H]2C)o1 |
| InChI | InChI=1S/C17H20N2O5S/c1-11-5-4-6-15(19(20)21)17(11)25(22,23)18(3)10-13-7-8-16(24-13)14-9-12(14)2/h4-8,12,14H,9-10H2,1-3H3/t12-,14+/m1/s1 |
| InChIKey | UYKJDUSGLLLKAA-OCCSQVGLSA-N |
| XLogP | 3.44 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|