C17H22N2O6S — CID 47020
Ammonium, (m-hydroxyphenyl)trimethyl-, methylsulfate, phenylcarbamate (PubChem CID 47020) has the molecular formula C17H22N2O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is methyl sulfate;trimethyl-[3-(phenylcarbamoyloxy)phenyl]azanium.
| Compound Name | Ammonium, (m-hydroxyphenyl)trimethyl-, methylsulfate, phenylcarbamate |
|---|---|
| PubChem CID | 47020 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl sulfate;trimethyl-[3-(phenylcarbamoyloxy)phenyl]azanium |
| SMILES | C[N+](C)(C)C1=CC(=CC=C1)OC(=O)NC2=CC=CC=C2.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H18N2O2.CH4O4S/c1-18(2,3)14-10-7-11-15(12-14)20-16(19)17-13-8-5-4-6-9-13;1-5-6(2,3)4/h4-12H,1-3H3;1H3,(H,2,3,4) |
| InChIKey | CQGHRZNZXOPOFO-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 113.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 410 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|