C11H10N4S — CID 47021451
6-ethyl-4-imidazol-1-ylthieno[2,3-d]pyrimidine (PubChem CID 47021451) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-ethyl-4-imidazol-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 6-ethyl-4-imidazol-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 47021451 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 6-ethyl-4-imidazol-1-ylthieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(-n3ccnc3)ncnc2s1 |
| InChI | InChI=1S/C11H10N4S/c1-2-8-5-9-10(15-4-3-12-7-15)13-6-14-11(9)16-8/h3-7H,2H2,1H3 |
| InChIKey | YDXPKCIMSYKISR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |