C17H17F3N2O4 — CID 47021752
1-[2-hydroxy-3-(4-methylphenoxy)propyl]-2-oxo-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 47021752) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(4-methylphenoxy)propyl]-2-oxo-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 1-[2-hydroxy-3-(4-methylphenoxy)propyl]-2-oxo-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47021752 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[2-hydroxy-3-(4-methylphenoxy)propyl]-2-oxo-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCC(O)Cn2c(C(F)(F)F)ccc(C(N)=O)c2=O)cc1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-10-2-4-12(5-3-10)26-9-11(23)8-22-14(17(18,19)20)7-6-13(15(21)24)16(22)25/h2-7,11,23H,8-9H2,1H3,(H2,21,24) |
| InChIKey | QXCSKOJFTAZUMU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |