C21H30N4OS — CID 47024260
1-(1-benzylpiperidin-4-yl)-3-[2-(dimethylamino)-2-thiophen-3-ylethyl]urea (PubChem CID 47024260) has the molecular formula C21H30N4OS and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[2-(dimethylamino)-2-thiophen-3-ylethyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(dimethylamino)-2-thiophen-3-ylethyl]urea |
|---|---|
| PubChem CID | 47024260 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(dimethylamino)-2-thiophen-3-ylethyl]urea |
| SMILES | CN(C)C(CNC(=O)NC1CCN(Cc2ccccc2)CC1)c1ccsc1 |
| InChI | InChI=1S/C21H30N4OS/c1-24(2)20(18-10-13-27-16-18)14-22-21(26)23-19-8-11-25(12-9-19)15-17-6-4-3-5-7-17/h3-7,10,13,16,19-20H,8-9,11-12,14-15H2,1-2H3,(H2,22,23,26) |
| InChIKey | LWWALWDHDZFGCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |