C16H26N4O2S — CID 95161216
1-(1-acetylpiperidin-4-yl)-3-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]urea (PubChem CID 95161216) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]urea |
|---|---|
| PubChem CID | 95161216 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]urea |
| SMILES | CC(=O)N1CCC(NC(=O)NC[C@@H](c2ccsc2)N(C)C)CC1 |
| InChI | InChI=1S/C16H26N4O2S/c1-12(21)20-7-4-14(5-8-20)18-16(22)17-10-15(19(2)3)13-6-9-23-11-13/h6,9,11,14-15H,4-5,7-8,10H2,1-3H3,(H2,17,18,22)/t15-/m0/s1 |
| InChIKey | GSBNKQVAABSHHG-HNNXBMFYSA-N |
| XLogP | 1.66 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |