C16H14Cl2N2O3 — CID 4702472
2,6-dichloro-N-[2-(4-nitrophenyl)propyl]benzamide (PubChem CID 4702472) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(4-nitrophenyl)propyl]benzamide.
| Compound Name | 2,6-dichloro-N-[2-(4-nitrophenyl)propyl]benzamide |
|---|---|
| PubChem CID | 4702472 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2,6-dichloro-N-[2-(4-nitrophenyl)propyl]benzamide |
| SMILES | CC(CNC(=O)c1c(Cl)cccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c1-10(11-5-7-12(8-6-11)20(22)23)9-19-16(21)15-13(17)3-2-4-14(15)18/h2-8,10H,9H2,1H3,(H,19,21) |
| InChIKey | KHLWGNRSAPYCTM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|