C17H15F3N2O3 — CID 1297065
N-[(2S)-2-(4-nitrophenyl)propyl]-3-(trifluoromethyl)benzamide (PubChem CID 1297065) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[(2S)-2-(4-nitrophenyl)propyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-(4-nitrophenyl)propyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 1297065 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[(2S)-2-(4-nitrophenyl)propyl]-3-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CNC(=O)c1cccc(C(F)(F)F)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15F3N2O3/c1-11(12-5-7-15(8-6-12)22(24)25)10-21-16(23)13-3-2-4-14(9-13)17(18,19)20/h2-9,11H,10H2,1H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | UMUBDVYDQMMGQT-LLVKDONJSA-N |
| XLogP | 4.15 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|