C20H22N4OS2 — CID 47024935
1-pyrazin-2-yl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 47024935) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 1-pyrazin-2-yl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 1-pyrazin-2-yl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47024935 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-pyrazin-2-yl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(C1CCCN(c2cnccn2)C1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C20H22N4OS2/c25-20(16-4-1-9-23(13-16)19-12-21-7-8-22-19)24(14-17-5-2-10-26-17)15-18-6-3-11-27-18/h2-3,5-8,10-12,16H,1,4,9,13-15H2 |
| InChIKey | HJZNCXROBLYLSW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |