C18H19N5O2 — CID 47025477
1-butyl-N-(2-imidazol-1-ylphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 47025477) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-butyl-N-(2-imidazol-1-ylphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(2-imidazol-1-ylphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 47025477 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-butyl-N-(2-imidazol-1-ylphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)Nc2ccccc2-n2ccnc2)ccc1=O |
| InChI | InChI=1S/C18H19N5O2/c1-2-3-11-23-17(24)9-8-15(21-23)18(25)20-14-6-4-5-7-16(14)22-12-10-19-13-22/h4-10,12-13H,2-3,11H2,1H3,(H,20,25) |
| InChIKey | ALUOEKHTKYFKPK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |