About ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate
ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate (PubChem CID 47027248) has the molecular formula C16H26N2O3
and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate |
| PubChem CID | 47027248 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2ncc(C(C)(C)C)o2)CC1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-20-15(19)12-6-8-18(9-7-12)11-14-17-10-13(21-14)16(2,3)4/h10,12H,5-9,11H2,1-4H3 |
| InChIKey | IQPWOSFDZFYKIW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate (CID 47027248) is ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(Cc2ncc(C(C)(C)C)o2)CC1.
What is the InChIKey of ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate?
The InChIKey is IQPWOSFDZFYKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-5-20-15(19)12-6-8-18(9-7-12)11-14-17-10-13(21-14)16(2,3)4/h10,12H,5-9,11H2,1-4H3.
What are the key properties of ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate?
ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate has a molecular weight of 294.39 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]piperidine-4-carboxylate is sourced from PubChem (CID 47027248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).