C12H22N4O2S — CID 47027427
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 47027427) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 47027427 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | Cc1c(C(C)NS(=O)(=O)N2CCCCC2)cnn1C |
| InChI | InChI=1S/C12H22N4O2S/c1-10(12-9-13-15(3)11(12)2)14-19(17,18)16-7-5-4-6-8-16/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | PGROLXVMBWUWRT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |