C15H17N7O3 — CID 47027864
2-cyclopropyl-5-[4-[(4-nitropyrazol-1-yl)methyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 47027864) has the molecular formula C15H17N7O3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-cyclopropyl-5-[4-[(4-nitropyrazol-1-yl)methyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-cyclopropyl-5-[4-[(4-nitropyrazol-1-yl)methyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 47027864 |
| Molecular Formula | C15H17N7O3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-cyclopropyl-5-[4-[(4-nitropyrazol-1-yl)methyl]piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(C2CC2)oc1N1CCN(Cn2cc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C15H17N7O3/c16-7-13-15(25-14(18-13)11-1-2-11)20-5-3-19(4-6-20)10-21-9-12(8-17-21)22(23)24/h8-9,11H,1-6,10H2 |
| InChIKey | CMOICHANWXAEGN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 117.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|