C20H21N3O3 — CID 47028446
1-[[4-[2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 47028446) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[[4-[2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 47028446 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[[4-[2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1ccc(C(=O)N2CCCC2c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c24-18-9-10-19(25)23(18)13-14-5-7-15(8-6-14)20(26)22-12-2-4-17(22)16-3-1-11-21-16/h1,3,5-8,11,17,21H,2,4,9-10,12-13H2 |
| InChIKey | AGOLOCUMPZNNEZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|